C20H22Cl4N6 — CID 91299306
2-[[[3-amino-3-(4-chlorophenyl)imino-2-methylpropyl]diazenyl]methyl]-3-chloro-N'-(2,4-dichlorophenyl)propanimidamide (PubChem CID 91299306) has the molecular formula C20H22Cl4N6 and a molecular weight of 488.25 g/mol. Its IUPAC name is 2-[[[3-amino-3-(4-chlorophenyl)imino-2-methylpropyl]diazenyl]methyl]-3-chloro-N'-(2,4-dichlorophenyl)propanimidamide.
| Compound Name | 2-[[[3-amino-3-(4-chlorophenyl)imino-2-methylpropyl]diazenyl]methyl]-3-chloro-N'-(2,4-dichlorophenyl)propanimidamide |
|---|---|
| PubChem CID | 91299306 |
| Molecular Formula | C20H22Cl4N6 |
| Molecular Weight | 488.25 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-[[[3-amino-3-(4-chlorophenyl)imino-2-methylpropyl]diazenyl]methyl]-3-chloro-N'-(2,4-dichlorophenyl)propanimidamide |
| SMILES | CC(C/N=N/CC(CCl)/C(N)=N/c1ccc(Cl)cc1Cl)/C(N)=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl4N6/c1-12(19(25)29-16-5-2-14(22)3-6-16)10-27-28-11-13(9-21)20(26)30-18-7-4-15(23)8-17(18)24/h2-8,12-13H,9-11H2,1H3,(H2,25,29)(H2,26,30)/b28-27+ |
| InChIKey | QOBBILISMXDJEV-BYYHNAKLSA-N |
| XLogP | 6.27 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.25 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|