C19H17Cl3N2O3 — CID 144743513
ethyl 2-amino-4-(4-chlorophenyl)-4-(2,4-dichlorophenyl)imino-3-(hydroxymethyl)but-2-enoate (PubChem CID 144743513) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is ethyl 2-amino-4-(4-chlorophenyl)-4-(2,4-dichlorophenyl)imino-3-(hydroxymethyl)but-2-enoate.
| Compound Name | ethyl 2-amino-4-(4-chlorophenyl)-4-(2,4-dichlorophenyl)imino-3-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 144743513 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | ethyl 2-amino-4-(4-chlorophenyl)-4-(2,4-dichlorophenyl)imino-3-(hydroxymethyl)but-2-enoate |
| SMILES | CCOC(=O)C(N)=C(CO)/C(=N\c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl3N2O3/c1-2-27-19(26)17(23)14(10-25)18(11-3-5-12(20)6-4-11)24-16-8-7-13(21)9-15(16)22/h3-9,25H,2,10,23H2,1H3/b17-14?,24-18- |
| InChIKey | PMMAXYCDYRPNNQ-SJAPUXSHSA-N |
| XLogP | 4.54 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|