C10H12Cl2N2 — CID 63174312
N'-(2,4-dichlorophenyl)-2-methylpropanimidamide (PubChem CID 63174312) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-2-methylpropanimidamide.
| Compound Name | N'-(2,4-dichlorophenyl)-2-methylpropanimidamide |
|---|---|
| PubChem CID | 63174312 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-2-methylpropanimidamide |
| SMILES | CC(C)/C(N)=N\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2/c1-6(2)10(13)14-9-4-3-7(11)5-8(9)12/h3-6H,1-2H3,(H2,13,14) |
| InChIKey | BIRISCIXPXHGPU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|