C15H14Cl2N2OS — CID 8776469
(2,4-dichlorophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate (PubChem CID 8776469) has the molecular formula C15H14Cl2N2OS and a molecular weight of 341.26 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate.
| Compound Name | (2,4-dichlorophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776469 |
| Molecular Formula | C15H14Cl2N2OS |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (2,4-dichlorophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate |
| SMILES | COc1ccccc1/N=C(\N)SCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2OS/c1-20-14-5-3-2-4-13(14)19-15(18)21-9-10-6-7-11(16)8-12(10)17/h2-8H,9H2,1H3,(H2,18,19) |
| InChIKey | GDNYWSBYHPXOJI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|