C18H19F3N2O2S — CID 8775208
(4,5-dimethoxy-2-methylphenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 8775208) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775208 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl N'-[2-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | COc1cc(C)c(CS/C(N)=N/c2ccccc2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C18H19F3N2O2S/c1-11-8-15(24-2)16(25-3)9-12(11)10-26-17(22)23-14-7-5-4-6-13(14)18(19,20)21/h4-9H,10H2,1-3H3,(H2,22,23) |
| InChIKey | VUDOASRRZSAEMR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|