C15H15BrN2OS — CID 8776508
(2-bromophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate (PubChem CID 8776508) has the molecular formula C15H15BrN2OS and a molecular weight of 351.27 g/mol. Its IUPAC name is (2-bromophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate.
| Compound Name | (2-bromophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776508 |
| Molecular Formula | C15H15BrN2OS |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | (2-bromophenyl)methyl N'-(2-methoxyphenyl)carbamimidothioate |
| SMILES | COc1ccccc1/N=C(\N)SCc1ccccc1Br |
| InChI | InChI=1S/C15H15BrN2OS/c1-19-14-9-5-4-8-13(14)18-15(17)20-10-11-6-2-3-7-12(11)16/h2-9H,10H2,1H3,(H2,17,18) |
| InChIKey | LMEOHTVWISORKR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|