About (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate
(2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate (PubChem CID 8775307) has the molecular formula C16H17BrN2OS
and a molecular weight of 365.30 g/mol. Its IUPAC name is (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate.
Molecular Properties
| Compound Name | (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate |
| PubChem CID | 8775307 |
| Molecular Formula | C16H17BrN2OS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate |
| SMILES | CCOc1ccc(/N=C(\N)SCc2ccccc2Br)cc1 |
| InChI | InChI=1S/C16H17BrN2OS/c1-2-20-14-9-7-13(8-10-14)19-16(18)21-11-12-5-3-4-6-15(12)17/h3-10H,2,11H2,1H3,(H2,18,19) |
| InChIKey | SXGFIQATFOVRBQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate?
The IUPAC name of (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate (CID 8775307) is (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate.
What is the SMILES notation for (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate?
The canonical SMILES for (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate is CCOc1ccc(/N=C(\N)SCc2ccccc2Br)cc1.
What is the InChIKey of (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate?
The InChIKey is SXGFIQATFOVRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrN2OS/c1-2-20-14-9-7-13(8-10-14)19-16(18)21-11-12-5-3-4-6-15(12)17/h3-10H,2,11H2,1H3,(H2,18,19).
What are the key properties of (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate?
(2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate has a molecular weight of 365.30 g/mol, XLogP of 4.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)methyl N'-(4-ethoxyphenyl)carbamimidothioate is sourced from PubChem (CID 8775307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).