C12H17BrN2OS — CID 8775867
(2-bromophenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate (PubChem CID 8775867) has the molecular formula C12H17BrN2OS and a molecular weight of 317.25 g/mol. Its IUPAC name is (2-bromophenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate.
| Compound Name | (2-bromophenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate |
|---|---|
| PubChem CID | 8775867 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (2-bromophenyl)methyl N'-[(2S)-1-methoxypropan-2-yl]carbamimidothioate |
| SMILES | COC[C@H](C)/N=C(\N)SCc1ccccc1Br |
| InChI | InChI=1S/C12H17BrN2OS/c1-9(7-16-2)15-12(14)17-8-10-5-3-4-6-11(10)13/h3-6,9H,7-8H2,1-2H3,(H2,14,15)/t9-/m0/s1 |
| InChIKey | LUZKJDFNKAIDDP-VIFPVBQESA-N |
| XLogP | 3.03 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|