C16H17ClN2S — CID 8775634
(2-chlorophenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate (PubChem CID 8775634) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate.
| Compound Name | (2-chlorophenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775634 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (2-chlorophenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
| SMILES | C[C@H](/N=C(\N)SCc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H17ClN2S/c1-12(13-7-3-2-4-8-13)19-16(18)20-11-14-9-5-6-10-15(14)17/h2-10,12H,11H2,1H3,(H2,18,19)/t12-/m0/s1 |
| InChIKey | LVVRIAVAYPUMBD-LBPRGKRZSA-N |
| XLogP | 4.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|