About (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate
(2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate (PubChem CID 6536764) has the molecular formula C13H16ClN3S
and a molecular weight of 281.81 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate |
| PubChem CID | 6536764 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate |
| SMILES | N/C(=N/N=C1CCCC1)SCc1ccccc1Cl |
| InChI | InChI=1S/C13H16ClN3S/c14-12-8-4-1-5-10(12)9-18-13(15)17-16-11-6-2-3-7-11/h1,4-5,8H,2-3,6-7,9H2,(H2,15,17) |
| InChIKey | YZERSIFOLYJWIV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate?
The IUPAC name of (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate (CID 6536764) is (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate.
What is the SMILES notation for (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate?
The canonical SMILES for (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate is N/C(=N/N=C1CCCC1)SCc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate?
The InChIKey is YZERSIFOLYJWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3S/c14-12-8-4-1-5-10(12)9-18-13(15)17-16-11-6-2-3-7-11/h1,4-5,8H,2-3,6-7,9H2,(H2,15,17).
What are the key properties of (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate?
(2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate has a molecular weight of 281.81 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate is sourced from PubChem (CID 6536764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).