C13H16ClN3S — CID 6536764
(2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate (PubChem CID 6536764) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate.
| Compound Name | (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 6536764 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (2-chlorophenyl)methyl N'-(cyclopentylideneamino)carbamimidothioate |
| SMILES | N/C(=N/N=C1CCCC1)SCc1ccccc1Cl |
| InChI | InChI=1S/C13H16ClN3S/c14-12-8-4-1-5-10(12)9-18-13(15)17-16-11-6-2-3-7-11/h1,4-5,8H,2-3,6-7,9H2,(H2,15,17) |
| InChIKey | YZERSIFOLYJWIV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|