C11H13ClN2 — CID 63174432
N'-[(2-chlorophenyl)methyl]cyclopropanecarboximidamide (PubChem CID 63174432) has the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. Its IUPAC name is N'-[(2-chlorophenyl)methyl]cyclopropanecarboximidamide.
| Compound Name | N'-[(2-chlorophenyl)methyl]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 63174432 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N'-[(2-chlorophenyl)methyl]cyclopropanecarboximidamide |
| SMILES | N/C(=N\Cc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C11H13ClN2/c12-10-4-2-1-3-9(10)7-14-11(13)8-5-6-8/h1-4,8H,5-7H2,(H2,13,14) |
| InChIKey | BSINUWIPLPTANW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|