C11H15N3 — CID 63175747
N'-[(6-methyl-2-pyridinyl)methyl]cyclopropanecarboximidamide (PubChem CID 63175747) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N'-[(6-methyl-2-pyridinyl)methyl]cyclopropanecarboximidamide.
| Compound Name | N'-[(6-methyl-2-pyridinyl)methyl]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 63175747 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N'-[(6-methyl-2-pyridinyl)methyl]cyclopropanecarboximidamide |
| SMILES | Cc1cccc(C/N=C(\N)C2CC2)n1 |
| InChI | InChI=1S/C11H15N3/c1-8-3-2-4-10(14-8)7-13-11(12)9-5-6-9/h2-4,9H,5-7H2,1H3,(H2,12,13) |
| InChIKey | HCAAFVMZPKSPRP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|