C8H12N4 — CID 62360074
2-[(6-methyl-2-pyridinyl)methyl]guanidine (PubChem CID 62360074) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-[(6-methyl-2-pyridinyl)methyl]guanidine.
| Compound Name | 2-[(6-methyl-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 62360074 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-[(6-methyl-2-pyridinyl)methyl]guanidine |
| SMILES | Cc1cccc(CN=C(N)N)n1 |
| InChI | InChI=1S/C8H12N4/c1-6-3-2-4-7(12-6)5-11-8(9)10/h2-4H,5H2,1H3,(H4,9,10,11) |
| InChIKey | WTJGYPIGZNPHBH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|