C10H16N4O — CID 79267709
N'-hydroxy-2-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]ethanimidamide (PubChem CID 79267709) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is N'-hydroxy-2-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 79267709 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N'-hydroxy-2-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]ethanimidamide |
| SMILES | Cc1cccc(CN(C)CC(N)=NO)n1 |
| InChI | InChI=1S/C10H16N4O/c1-8-4-3-5-9(12-8)6-14(2)7-10(11)13-15/h3-5,15H,6-7H2,1-2H3,(H2,11,13) |
| InChIKey | JCWHYFXHVVZZHK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|