C11H15BF3N2- — CID 106746198
trifluoro-[3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]prop-1-en-2-yl]boranuide (PubChem CID 106746198) has the molecular formula C11H15BF3N2- and a molecular weight of 243.06 g/mol. Its IUPAC name is trifluoro-[3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]prop-1-en-2-yl]boranuide.
| Compound Name | trifluoro-[3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746198 |
| Molecular Formula | C11H15BF3N2- |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | trifluoro-[3-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN(C)Cc1cccc(C)n1)[B-](F)(F)F |
| InChI | InChI=1S/C11H15BF3N2/c1-9(12(13,14)15)7-17(3)8-11-6-4-5-10(2)16-11/h4-6H,1,7-8H2,2-3H3/q-1 |
| InChIKey | KISGBDSZYMYFLO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|