C10H14N2 — CID 167486636
N-methyl-N-[(6-methyl-2-pyridinyl)methyl]ethenamine (PubChem CID 167486636) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-methyl-N-[(6-methyl-2-pyridinyl)methyl]ethenamine.
| Compound Name | N-methyl-N-[(6-methyl-2-pyridinyl)methyl]ethenamine |
|---|---|
| PubChem CID | 167486636 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-methyl-N-[(6-methyl-2-pyridinyl)methyl]ethenamine |
| SMILES | C=CN(C)Cc1cccc(C)n1 |
| InChI | InChI=1S/C10H14N2/c1-4-12(3)8-10-7-5-6-9(2)11-10/h4-7H,1,8H2,2-3H3 |
| InChIKey | HSXHFPCPJSXRKW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |