C7H11NS — CID 134564621
2,6-dimethylpyridine;sulfane (PubChem CID 134564621) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 2,6-dimethylpyridine;sulfane.
| Compound Name | 2,6-dimethylpyridine;sulfane |
|---|---|
| PubChem CID | 134564621 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2,6-dimethylpyridine;sulfane |
| SMILES | Cc1cccc(C)n1.S |
| InChI | InChI=1S/C7H9N.H2S/c1-6-4-3-5-7(2)8-6;/h3-5H,1-2H3;1H2 |
| InChIKey | TZEDGZGLNCMLMV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |