About 2,6-dimethylpyridine;tetrachlorotitanium
2,6-dimethylpyridine;tetrachlorotitanium (PubChem CID 166444625) has the molecular formula C7H9Cl4NTi
and a molecular weight of 296.84 g/mol. Its IUPAC name is 2,6-dimethylpyridine;tetrachlorotitanium.
Molecular Properties
| Compound Name | 2,6-dimethylpyridine;tetrachlorotitanium |
| PubChem CID | 166444625 |
| Molecular Formula | C7H9Cl4NTi |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 294.90 |
| IUPAC Name | 2,6-dimethylpyridine;tetrachlorotitanium |
| SMILES | Cc1cccc(C)n1.Cl[Ti](Cl)(Cl)Cl |
| InChI | InChI=1S/C7H9N.4ClH.Ti/c1-6-4-3-5-7(2)8-6;;;;;/h3-5H,1-2H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | GIAFRSIBRQDLHY-UHFFFAOYSA-J |
| XLogP | 4.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethylpyridine;tetrachlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylpyridine;tetrachlorotitanium?
The IUPAC name of 2,6-dimethylpyridine;tetrachlorotitanium (CID 166444625) is 2,6-dimethylpyridine;tetrachlorotitanium.
What is the SMILES notation for 2,6-dimethylpyridine;tetrachlorotitanium?
The canonical SMILES for 2,6-dimethylpyridine;tetrachlorotitanium is Cc1cccc(C)n1.Cl[Ti](Cl)(Cl)Cl.
What is the InChIKey of 2,6-dimethylpyridine;tetrachlorotitanium?
The InChIKey is GIAFRSIBRQDLHY-UHFFFAOYSA-J. The full InChI is InChI=1S/C7H9N.4ClH.Ti/c1-6-4-3-5-7(2)8-6;;;;;/h3-5H,1-2H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of 2,6-dimethylpyridine;tetrachlorotitanium?
2,6-dimethylpyridine;tetrachlorotitanium has a molecular weight of 296.84 g/mol, XLogP of 4.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylpyridine;tetrachlorotitanium is sourced from PubChem (CID 166444625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).