About carbon monoxide;2,6-dimethylpyridine;tungsten
carbon monoxide;2,6-dimethylpyridine;tungsten (PubChem CID 520783) has the molecular formula C12H9NO5W
and a molecular weight of 431.05 g/mol. Its IUPAC name is carbon monoxide;2,6-dimethylpyridine;tungsten.
Molecular Properties
| Compound Name | carbon monoxide;2,6-dimethylpyridine;tungsten |
| PubChem CID | 520783 |
| Molecular Formula | C12H9NO5W |
| Molecular Weight | 431.05 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | carbon monoxide;2,6-dimethylpyridine;tungsten |
| SMILES | Cc1cccc(C)n1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C7H9N.5CO.W/c1-6-4-3-5-7(2)8-6;5*1-2;/h3-5H,1-2H3;;;;;; |
| InChIKey | KPPMZXMLXJIOEG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 112.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.05 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;2,6-dimethylpyridine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;2,6-dimethylpyridine;tungsten?
The IUPAC name of carbon monoxide;2,6-dimethylpyridine;tungsten (CID 520783) is carbon monoxide;2,6-dimethylpyridine;tungsten.
What is the SMILES notation for carbon monoxide;2,6-dimethylpyridine;tungsten?
The canonical SMILES for carbon monoxide;2,6-dimethylpyridine;tungsten is Cc1cccc(C)n1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;2,6-dimethylpyridine;tungsten?
The InChIKey is KPPMZXMLXJIOEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.5CO.W/c1-6-4-3-5-7(2)8-6;5*1-2;/h3-5H,1-2H3;;;;;;.
What are the key properties of carbon monoxide;2,6-dimethylpyridine;tungsten?
carbon monoxide;2,6-dimethylpyridine;tungsten has a molecular weight of 431.05 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;2,6-dimethylpyridine;tungsten is sourced from PubChem (CID 520783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).