About 2,10-dimethylazecine
2,10-dimethylazecine (PubChem CID 126659012) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2,10-dimethylazecine.
Molecular Properties
| Compound Name | 2,10-dimethylazecine |
| PubChem CID | 126659012 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2,10-dimethylazecine |
| SMILES | Cc1cccccccc(C)n1 |
| InChI | InChI=1S/C11H13N/c1-10-8-6-4-3-5-7-9-11(2)12-10/h3-9H,1-2H3/b4-3-,5-3+,6-4-,7-5+,8-6-,9-7-,10-8+,11-9-,12-10+,12-11- |
| InChIKey | SGZUGQUQNPHLAF-HWMFZYLESA-N |
| XLogP | 2.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,10-dimethylazecine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-dimethylazecine?
The IUPAC name of 2,10-dimethylazecine (CID 126659012) is 2,10-dimethylazecine.
What is the SMILES notation for 2,10-dimethylazecine?
The canonical SMILES for 2,10-dimethylazecine is Cc1cccccccc(C)n1.
What is the InChIKey of 2,10-dimethylazecine?
The InChIKey is SGZUGQUQNPHLAF-HWMFZYLESA-N. The full InChI is InChI=1S/C11H13N/c1-10-8-6-4-3-5-7-9-11(2)12-10/h3-9H,1-2H3/b4-3-,5-3+,6-4-,7-5+,8-6-,9-7-,10-8+,11-9-,12-10+,12-11-.
What are the key properties of 2,10-dimethylazecine?
2,10-dimethylazecine has a molecular weight of 159.23 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-dimethylazecine is sourced from PubChem (CID 126659012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).