C11H13N — CID 126659012
2,10-dimethylazecine (PubChem CID 126659012) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 2,10-dimethylazecine.
| Compound Name | 2,10-dimethylazecine |
|---|---|
| PubChem CID | 126659012 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2,10-dimethylazecine |
| SMILES | Cc1cccccccc(C)n1 |
| InChI | InChI=1S/C11H13N/c1-10-8-6-4-3-5-7-9-11(2)12-10/h3-9H,1-2H3/b4-3-,5-3+,6-4-,7-5+,8-6-,9-7-,10-8+,11-9-,12-10+,12-11- |
| InChIKey | SGZUGQUQNPHLAF-HWMFZYLESA-N |
| XLogP | 2.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |