C9H15N — CID 54453947
2,6-dimethylpyridine;ethane (PubChem CID 54453947) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 2,6-dimethylpyridine;ethane.
| Compound Name | 2,6-dimethylpyridine;ethane |
|---|---|
| PubChem CID | 54453947 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2,6-dimethylpyridine;ethane |
| SMILES | CC.Cc1cccc(C)n1 |
| InChI | InChI=1S/C7H9N.C2H6/c1-6-4-3-5-7(2)8-6;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | WWWDSVIWTXWPFY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |