About ethane;ethene;6-methylpyridin-2-amine
ethane;ethene;6-methylpyridin-2-amine (PubChem CID 143179196) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;ethene;6-methylpyridin-2-amine.
Molecular Properties
| Compound Name | ethane;ethene;6-methylpyridin-2-amine |
| PubChem CID | 143179196 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;ethene;6-methylpyridin-2-amine |
| SMILES | C=C.CC.Cc1cccc(N)n1 |
| InChI | InChI=1S/C6H8N2.C2H6.C2H4/c1-5-3-2-4-6(7)8-5;2*1-2/h2-4H,1H3,(H2,7,8);1-2H3;1-2H2 |
| InChIKey | ZWDWKDNKNDDZRP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;6-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;6-methylpyridin-2-amine?
The IUPAC name of ethane;ethene;6-methylpyridin-2-amine (CID 143179196) is ethane;ethene;6-methylpyridin-2-amine.
What is the SMILES notation for ethane;ethene;6-methylpyridin-2-amine?
The canonical SMILES for ethane;ethene;6-methylpyridin-2-amine is C=C.CC.Cc1cccc(N)n1.
What is the InChIKey of ethane;ethene;6-methylpyridin-2-amine?
The InChIKey is ZWDWKDNKNDDZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C2H6.C2H4/c1-5-3-2-4-6(7)8-5;2*1-2/h2-4H,1H3,(H2,7,8);1-2H3;1-2H2.
What are the key properties of ethane;ethene;6-methylpyridin-2-amine?
ethane;ethene;6-methylpyridin-2-amine has a molecular weight of 166.27 g/mol, XLogP of 2.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;6-methylpyridin-2-amine is sourced from PubChem (CID 143179196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).