About 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline
6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline (PubChem CID 143075004) has the molecular formula C18H20N6
and a molecular weight of 320.40 g/mol. Its IUPAC name is 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline.
Molecular Properties
| Compound Name | 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline |
| PubChem CID | 143075004 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline |
| SMILES | Cc1cccc(/N=N/c2ccc(N)cc2)n1.Cc1cccc(N)n1 |
| InChI | InChI=1S/C12H12N4.C6H8N2/c1-9-3-2-4-12(14-9)16-15-11-7-5-10(13)6-8-11;1-5-3-2-4-6(7)8-5/h2-8H,13H2,1H3;2-4H,1H3,(H2,7,8)/b16-15+; |
| InChIKey | HXMHIFMZLHGUNZ-GEEYTBSJSA-N |
| XLogP | 4.36 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline?
The IUPAC name of 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline (CID 143075004) is 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline.
What is the SMILES notation for 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline?
The canonical SMILES for 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline is Cc1cccc(/N=N/c2ccc(N)cc2)n1.Cc1cccc(N)n1.
What is the InChIKey of 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline?
The InChIKey is HXMHIFMZLHGUNZ-GEEYTBSJSA-N. The full InChI is InChI=1S/C12H12N4.C6H8N2/c1-9-3-2-4-12(14-9)16-15-11-7-5-10(13)6-8-11;1-5-3-2-4-6(7)8-5/h2-8H,13H2,1H3;2-4H,1H3,(H2,7,8)/b16-15+;.
What are the key properties of 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline?
6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline has a molecular weight of 320.40 g/mol, XLogP of 4.36, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyridin-2-amine;4-[(6-methyl-2-pyridinyl)diazenyl]aniline is sourced from PubChem (CID 143075004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).