About 6-methylpyridin-2-amine;piperazine
6-methylpyridin-2-amine;piperazine (PubChem CID 143304995) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 6-methylpyridin-2-amine;piperazine.
Molecular Properties
| Compound Name | 6-methylpyridin-2-amine;piperazine |
| PubChem CID | 143304995 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 6-methylpyridin-2-amine;piperazine |
| SMILES | C1CNCCN1.Cc1cccc(N)n1 |
| InChI | InChI=1S/C6H8N2.C4H10N2/c1-5-3-2-4-6(7)8-5;1-2-6-4-3-5-1/h2-4H,1H3,(H2,7,8);5-6H,1-4H2 |
| InChIKey | DADAWLNBZRUQSB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylpyridin-2-amine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyridin-2-amine;piperazine?
The IUPAC name of 6-methylpyridin-2-amine;piperazine (CID 143304995) is 6-methylpyridin-2-amine;piperazine.
What is the SMILES notation for 6-methylpyridin-2-amine;piperazine?
The canonical SMILES for 6-methylpyridin-2-amine;piperazine is C1CNCCN1.Cc1cccc(N)n1.
What is the InChIKey of 6-methylpyridin-2-amine;piperazine?
The InChIKey is DADAWLNBZRUQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C4H10N2/c1-5-3-2-4-6(7)8-5;1-2-6-4-3-5-1/h2-4H,1H3,(H2,7,8);5-6H,1-4H2.
What are the key properties of 6-methylpyridin-2-amine;piperazine?
6-methylpyridin-2-amine;piperazine has a molecular weight of 194.28 g/mol, XLogP of 0.15, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyridin-2-amine;piperazine is sourced from PubChem (CID 143304995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).