About 6-chloropyridin-2-amine;ethane
6-chloropyridin-2-amine;ethane (PubChem CID 143370846) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is 6-chloropyridin-2-amine;ethane.
Molecular Properties
| Compound Name | 6-chloropyridin-2-amine;ethane |
| PubChem CID | 143370846 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 6-chloropyridin-2-amine;ethane |
| SMILES | CC.Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C5H5ClN2.C2H6/c6-4-2-1-3-5(7)8-4;1-2/h1-3H,(H2,7,8);1-2H3 |
| InChIKey | JXJGNJYVRMVSTB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropyridin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyridin-2-amine;ethane?
The IUPAC name of 6-chloropyridin-2-amine;ethane (CID 143370846) is 6-chloropyridin-2-amine;ethane.
What is the SMILES notation for 6-chloropyridin-2-amine;ethane?
The canonical SMILES for 6-chloropyridin-2-amine;ethane is CC.Nc1cccc(Cl)n1.
What is the InChIKey of 6-chloropyridin-2-amine;ethane?
The InChIKey is JXJGNJYVRMVSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2.C2H6/c6-4-2-1-3-5(7)8-4;1-2/h1-3H,(H2,7,8);1-2H3.
What are the key properties of 6-chloropyridin-2-amine;ethane?
6-chloropyridin-2-amine;ethane has a molecular weight of 158.63 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyridin-2-amine;ethane is sourced from PubChem (CID 143370846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).