About 2,6-dimethylpyridine;trichloroborane
2,6-dimethylpyridine;trichloroborane (PubChem CID 72792978) has the molecular formula C7H9BCl3N
and a molecular weight of 224.33 g/mol. Its IUPAC name is 2,6-dimethylpyridine;trichloroborane.
Molecular Properties
| Compound Name | 2,6-dimethylpyridine;trichloroborane |
| PubChem CID | 72792978 |
| Molecular Formula | C7H9BCl3N |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 2,6-dimethylpyridine;trichloroborane |
| SMILES | Cc1cccc(C)n1.ClB(Cl)Cl |
| InChI | InChI=1S/C7H9N.BCl3/c1-6-4-3-5-7(2)8-6;2-1(3)4/h3-5H,1-2H3; |
| InChIKey | FIYPUVVQZBZEJR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylpyridine;trichloroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylpyridine;trichloroborane?
The IUPAC name of 2,6-dimethylpyridine;trichloroborane (CID 72792978) is 2,6-dimethylpyridine;trichloroborane.
What is the SMILES notation for 2,6-dimethylpyridine;trichloroborane?
The canonical SMILES for 2,6-dimethylpyridine;trichloroborane is Cc1cccc(C)n1.ClB(Cl)Cl.
What is the InChIKey of 2,6-dimethylpyridine;trichloroborane?
The InChIKey is FIYPUVVQZBZEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.BCl3/c1-6-4-3-5-7(2)8-6;2-1(3)4/h3-5H,1-2H3;.
What are the key properties of 2,6-dimethylpyridine;trichloroborane?
2,6-dimethylpyridine;trichloroborane has a molecular weight of 224.33 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylpyridine;trichloroborane is sourced from PubChem (CID 72792978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).