About N,N-diethylethanamine;2,6-dimethylpyridine
N,N-diethylethanamine;2,6-dimethylpyridine (PubChem CID 90016440) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N,N-diethylethanamine;2,6-dimethylpyridine.
Molecular Properties
| Compound Name | N,N-diethylethanamine;2,6-dimethylpyridine |
| PubChem CID | 90016440 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N,N-diethylethanamine;2,6-dimethylpyridine |
| SMILES | CCN(CC)CC.Cc1cccc(C)n1 |
| InChI | InChI=1S/C7H9N.C6H15N/c1-6-4-3-5-7(2)8-6;1-4-7(5-2)6-3/h3-5H,1-2H3;4-6H2,1-3H3 |
| InChIKey | WFXOUXPYZWMENX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;2,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;2,6-dimethylpyridine?
The IUPAC name of N,N-diethylethanamine;2,6-dimethylpyridine (CID 90016440) is N,N-diethylethanamine;2,6-dimethylpyridine.
What is the SMILES notation for N,N-diethylethanamine;2,6-dimethylpyridine?
The canonical SMILES for N,N-diethylethanamine;2,6-dimethylpyridine is CCN(CC)CC.Cc1cccc(C)n1.
What is the InChIKey of N,N-diethylethanamine;2,6-dimethylpyridine?
The InChIKey is WFXOUXPYZWMENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H15N/c1-6-4-3-5-7(2)8-6;1-4-7(5-2)6-3/h3-5H,1-2H3;4-6H2,1-3H3.
What are the key properties of N,N-diethylethanamine;2,6-dimethylpyridine?
N,N-diethylethanamine;2,6-dimethylpyridine has a molecular weight of 208.35 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;2,6-dimethylpyridine is sourced from PubChem (CID 90016440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).