C13H24N2 — CID 90016440
N,N-diethylethanamine;2,6-dimethylpyridine (PubChem CID 90016440) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N,N-diethylethanamine;2,6-dimethylpyridine.
| Compound Name | N,N-diethylethanamine;2,6-dimethylpyridine |
|---|---|
| PubChem CID | 90016440 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N,N-diethylethanamine;2,6-dimethylpyridine |
| SMILES | CCN(CC)CC.Cc1cccc(C)n1 |
| InChI | InChI=1S/C7H9N.C6H15N/c1-6-4-3-5-7(2)8-6;1-4-7(5-2)6-3/h3-5H,1-2H3;4-6H2,1-3H3 |
| InChIKey | WFXOUXPYZWMENX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |