C15H21ClN2O — CID 103293426
N'-[(2-chloro-6-methoxyphenyl)methyl]cyclohexanecarboximidamide (PubChem CID 103293426) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is N'-[(2-chloro-6-methoxyphenyl)methyl]cyclohexanecarboximidamide.
| Compound Name | N'-[(2-chloro-6-methoxyphenyl)methyl]cyclohexanecarboximidamide |
|---|---|
| PubChem CID | 103293426 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N'-[(2-chloro-6-methoxyphenyl)methyl]cyclohexanecarboximidamide |
| SMILES | COc1cccc(Cl)c1C/N=C(\N)C1CCCCC1 |
| InChI | InChI=1S/C15H21ClN2O/c1-19-14-9-5-8-13(16)12(14)10-18-15(17)11-6-3-2-4-7-11/h5,8-9,11H,2-4,6-7,10H2,1H3,(H2,17,18) |
| InChIKey | QWBFGALDZKLOKG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|