C14H17F3N2 — CID 63173633
N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentanecarboximidamide (PubChem CID 63173633) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentanecarboximidamide.
| Compound Name | N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 63173633 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentanecarboximidamide |
| SMILES | N/C(=N\Cc1ccccc1C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C14H17F3N2/c15-14(16,17)12-8-4-3-7-11(12)9-19-13(18)10-5-1-2-6-10/h3-4,7-8,10H,1-2,5-6,9H2,(H2,18,19) |
| InChIKey | BOQKYYNIOKPNHX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|