C12H15F3N2 — CID 63173587
N'-[[2-(trifluoromethyl)phenyl]methyl]butanimidamide (PubChem CID 63173587) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is N'-[[2-(trifluoromethyl)phenyl]methyl]butanimidamide.
| Compound Name | N'-[[2-(trifluoromethyl)phenyl]methyl]butanimidamide |
|---|---|
| PubChem CID | 63173587 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N'-[[2-(trifluoromethyl)phenyl]methyl]butanimidamide |
| SMILES | CCC/C(N)=N\Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2/c1-2-5-11(16)17-8-9-6-3-4-7-10(9)12(13,14)15/h3-4,6-7H,2,5,8H2,1H3,(H2,16,17) |
| InChIKey | HRQBJRLCFYZTNM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|