C10H10ClN5O — CID 70642650
4-amino-N'-[(2-chlorophenyl)methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 70642650) has the molecular formula C10H10ClN5O and a molecular weight of 251.68 g/mol. Its IUPAC name is 4-amino-N'-[(2-chlorophenyl)methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(2-chlorophenyl)methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 70642650 |
| Molecular Formula | C10H10ClN5O |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-amino-N'-[(2-chlorophenyl)methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\Cc1ccccc1Cl)c1nonc1N |
| InChI | InChI=1S/C10H10ClN5O/c11-7-4-2-1-3-6(7)5-14-9(12)8-10(13)16-17-15-8/h1-4H,5H2,(H2,12,14)(H2,13,16) |
| InChIKey | JHYJFWRIHMWLKR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|