C28H29Cl2N7 — CID 169205739
2-amino-N'-[(2-chlorophenyl)methyl]benzenecarboximidamide;N'-[(2-chlorophenyl)methyl]-2-hydrazinylbenzenecarboximidamide (PubChem CID 169205739) has the molecular formula C28H29Cl2N7 and a molecular weight of 534.50 g/mol. Its IUPAC name is 2-amino-N'-[(2-chlorophenyl)methyl]benzenecarboximidamide;N'-[(2-chlorophenyl)methyl]-2-hydrazinylbenzenecarboximidamide.
| Compound Name | 2-amino-N'-[(2-chlorophenyl)methyl]benzenecarboximidamide;N'-[(2-chlorophenyl)methyl]-2-hydrazinylbenzenecarboximidamide |
|---|---|
| PubChem CID | 169205739 |
| Molecular Formula | C28H29Cl2N7 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 2-amino-N'-[(2-chlorophenyl)methyl]benzenecarboximidamide;N'-[(2-chlorophenyl)methyl]-2-hydrazinylbenzenecarboximidamide |
| SMILES | N/C(=N\Cc1ccccc1Cl)c1ccccc1N.NNc1ccccc1/C(N)=N/Cc1ccccc1Cl |
| InChI | InChI=1S/C14H15ClN4.C14H14ClN3/c15-12-7-3-1-5-10(12)9-18-14(16)11-6-2-4-8-13(11)19-17;15-12-7-3-1-5-10(12)9-18-14(17)11-6-2-4-8-13(11)16/h1-8,19H,9,17H2,(H2,16,18);1-8H,9,16H2,(H2,17,18) |
| InChIKey | DLJXDHZIDRVXMZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|