C7H10N4 — CID 10307874
N',2-diaminobenzenecarboximidamide (PubChem CID 10307874) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is N',2-diaminobenzenecarboximidamide.
| Compound Name | N',2-diaminobenzenecarboximidamide |
|---|---|
| PubChem CID | 10307874 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N',2-diaminobenzenecarboximidamide |
| SMILES | N/N=C(/N)c1ccccc1N |
| InChI | InChI=1S/C7H10N4/c8-6-4-2-1-3-5(6)7(9)11-10/h1-4H,8,10H2,(H2,9,11) |
| InChIKey | FMDCTRXTGDRGGP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|