C15H17N3 — CID 101481145
2-amino-N'-(2,5-dimethylphenyl)benzenecarboximidamide (PubChem CID 101481145) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-amino-N'-(2,5-dimethylphenyl)benzenecarboximidamide.
| Compound Name | 2-amino-N'-(2,5-dimethylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 101481145 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-amino-N'-(2,5-dimethylphenyl)benzenecarboximidamide |
| SMILES | Cc1ccc(C)c(/N=C(\N)c2ccccc2N)c1 |
| InChI | InChI=1S/C15H17N3/c1-10-7-8-11(2)14(9-10)18-15(17)12-5-3-4-6-13(12)16/h3-9H,16H2,1-2H3,(H2,17,18) |
| InChIKey | SFRJACOKSIXLRF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|