C22H22N2S — CID 8776178
benzhydryl N'-(2,5-dimethylphenyl)carbamimidothioate (PubChem CID 8776178) has the molecular formula C22H22N2S and a molecular weight of 346.50 g/mol. Its IUPAC name is benzhydryl N'-(2,5-dimethylphenyl)carbamimidothioate.
| Compound Name | benzhydryl N'-(2,5-dimethylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 8776178 |
| Molecular Formula | C22H22N2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | benzhydryl N'-(2,5-dimethylphenyl)carbamimidothioate |
| SMILES | Cc1ccc(C)c(/N=C(\N)SC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2S/c1-16-13-14-17(2)20(15-16)24-22(23)25-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,21H,1-2H3,(H2,23,24) |
| InChIKey | FDUSUPFCJFIWDP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|