C16H17NOS — CID 18138315
2-(2,5-dimethylphenyl)sulfanyl-2-phenylacetamide (PubChem CID 18138315) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)sulfanyl-2-phenylacetamide.
| Compound Name | 2-(2,5-dimethylphenyl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 18138315 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(2,5-dimethylphenyl)sulfanyl-2-phenylacetamide |
| SMILES | Cc1ccc(C)c(SC(C(N)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H17NOS/c1-11-8-9-12(2)14(10-11)19-15(16(17)18)13-6-4-3-5-7-13/h3-10,15H,1-2H3,(H2,17,18) |
| InChIKey | NYMIKPLEJGNAEM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |