C14H12FNO2S — CID 71981299
2-(4-fluorophenyl)-2-(2-hydroxyphenyl)sulfanylacetamide (PubChem CID 71981299) has the molecular formula C14H12FNO2S and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-(2-hydroxyphenyl)sulfanylacetamide.
| Compound Name | 2-(4-fluorophenyl)-2-(2-hydroxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 71981299 |
| Molecular Formula | C14H12FNO2S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-(4-fluorophenyl)-2-(2-hydroxyphenyl)sulfanylacetamide |
| SMILES | NC(=O)C(Sc1ccccc1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FNO2S/c15-10-7-5-9(6-8-10)13(14(16)18)19-12-4-2-1-3-11(12)17/h1-8,13,17H,(H2,16,18) |
| InChIKey | MKQSBMXVVXUTDN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |