C16H10F4N2OS — CID 146088281
2-[4-cyano-3-(trifluoromethyl)phenyl]sulfanyl-2-(4-fluorophenyl)acetamide (PubChem CID 146088281) has the molecular formula C16H10F4N2OS and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-[4-cyano-3-(trifluoromethyl)phenyl]sulfanyl-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-cyano-3-(trifluoromethyl)phenyl]sulfanyl-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 146088281 |
| Molecular Formula | C16H10F4N2OS |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-[4-cyano-3-(trifluoromethyl)phenyl]sulfanyl-2-(4-fluorophenyl)acetamide |
| SMILES | N#Cc1ccc(SC(C(N)=O)c2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10F4N2OS/c17-11-4-1-9(2-5-11)14(15(22)23)24-12-6-3-10(8-21)13(7-12)16(18,19)20/h1-7,14H,(H2,22,23) |
| InChIKey | YSVDZYPLTYRHCR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |