C14H12FN5OS2 — CID 43040534
2-(4-fluorophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 43040534) has the molecular formula C14H12FN5OS2 and a molecular weight of 349.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | 2-(4-fluorophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 43040534 |
| Molecular Formula | C14H12FN5OS2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | NC(=O)C(Sc1nnnn1Cc1cccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FN5OS2/c15-10-5-3-9(4-6-10)12(13(16)21)23-14-17-18-19-20(14)8-11-2-1-7-22-11/h1-7,12H,8H2,(H2,16,21) |
| InChIKey | JYTNHIQQGMVGAG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |