C12H13N5OS2 — CID 47145688
N-prop-2-ynyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 47145688) has the molecular formula C12H13N5OS2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-prop-2-ynyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-prop-2-ynyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 47145688 |
| Molecular Formula | C12H13N5OS2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-prop-2-ynyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | C#CCNC(=O)C(C)Sc1nnnn1Cc1cccs1 |
| InChI | InChI=1S/C12H13N5OS2/c1-3-6-13-11(18)9(2)20-12-14-15-16-17(12)8-10-5-4-7-19-10/h1,4-5,7,9H,6,8H2,2H3,(H,13,18) |
| InChIKey | DQGZMISCCPPYKH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|