C17H17N5OS2 — CID 46639465
N-cyclopropyl-2-phenyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 46639465) has the molecular formula C17H17N5OS2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-cyclopropyl-2-phenyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-cyclopropyl-2-phenyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46639465 |
| Molecular Formula | C17H17N5OS2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-cyclopropyl-2-phenyl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(NC1CC1)C(Sc1nnnn1Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C17H17N5OS2/c23-16(18-13-8-9-13)15(12-5-2-1-3-6-12)25-17-19-20-21-22(17)11-14-7-4-10-24-14/h1-7,10,13,15H,8-9,11H2,(H,18,23) |
| InChIKey | INSDXVDABMRNNS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |