C19H19N5OS — CID 46640476
2-(1-benzyltetrazol-5-yl)sulfanyl-N-cyclopropyl-2-phenylacetamide (PubChem CID 46640476) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-(1-benzyltetrazol-5-yl)sulfanyl-N-cyclopropyl-2-phenylacetamide.
| Compound Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-N-cyclopropyl-2-phenylacetamide |
|---|---|
| PubChem CID | 46640476 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-N-cyclopropyl-2-phenylacetamide |
| SMILES | O=C(NC1CC1)C(Sc1nnnn1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19N5OS/c25-18(20-16-11-12-16)17(15-9-5-2-6-10-15)26-19-21-22-23-24(19)13-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2,(H,20,25) |
| InChIKey | SVRADGGLULVGHC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |