C19H17N5OS2 — CID 51244536
N-naphthalen-2-yl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 51244536) has the molecular formula C19H17N5OS2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-naphthalen-2-yl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 51244536 |
| Molecular Formula | C19H17N5OS2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-naphthalen-2-yl-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1Cc1cccs1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H17N5OS2/c1-13(27-19-21-22-23-24(19)12-17-7-4-10-26-17)18(25)20-16-9-8-14-5-2-3-6-15(14)11-16/h2-11,13H,12H2,1H3,(H,20,25) |
| InChIKey | RTELJSPOTKYXGH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |