C15H14BrN5OS2 — CID 46649990
N-(3-bromophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 46649990) has the molecular formula C15H14BrN5OS2 and a molecular weight of 424.35 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(3-bromophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46649990 |
| Molecular Formula | C15H14BrN5OS2 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | N-(3-bromophenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1Cc1cccs1)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C15H14BrN5OS2/c1-10(14(22)17-12-5-2-4-11(16)8-12)24-15-18-19-20-21(15)9-13-6-3-7-23-13/h2-8,10H,9H2,1H3,(H,17,22) |
| InChIKey | FPOLOSIVOPGVHH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |