C16H16FN5OS2 — CID 86919369
N-[(2-fluorophenyl)methyl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 86919369) has the molecular formula C16H16FN5OS2 and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 86919369 |
| Molecular Formula | C16H16FN5OS2 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1Cc1cccs1)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C16H16FN5OS2/c1-11(15(23)18-9-12-5-2-3-7-14(12)17)25-16-19-20-21-22(16)10-13-6-4-8-24-13/h2-8,11H,9-10H2,1H3,(H,18,23) |
| InChIKey | BBNJOISTEXPDDO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |