C16H16BrN5OS2 — CID 46639627
N-(2-bromo-4-methylphenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 46639627) has the molecular formula C16H16BrN5OS2 and a molecular weight of 438.38 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46639627 |
| Molecular Formula | C16H16BrN5OS2 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | Cc1ccc(NC(=O)C(C)Sc2nnnn2Cc2cccs2)c(Br)c1 |
| InChI | InChI=1S/C16H16BrN5OS2/c1-10-5-6-14(13(17)8-10)18-15(23)11(2)25-16-19-20-21-22(16)9-12-4-3-7-24-12/h3-8,11H,9H2,1-2H3,(H,18,23) |
| InChIKey | HWQBXTBJXILBBD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |