C13H14N4OS2 — CID 47145785
2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-ynylpropanamide (PubChem CID 47145785) has the molecular formula C13H14N4OS2 and a molecular weight of 306.42 g/mol. Its IUPAC name is 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 47145785 |
| Molecular Formula | C13H14N4OS2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)Sc1nnc(-c2cccs2)n1C |
| InChI | InChI=1S/C13H14N4OS2/c1-4-7-14-12(18)9(2)20-13-16-15-11(17(13)3)10-6-5-8-19-10/h1,5-6,8-9H,7H2,2-3H3,(H,14,18) |
| InChIKey | VVIVCPRNAFXXCE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|