C13H16ClN3O4S2 — CID 161441258
(2R)-2-chloropropanoic acid;2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid (PubChem CID 161441258) has the molecular formula C13H16ClN3O4S2 and a molecular weight of 377.88 g/mol. Its IUPAC name is (2R)-2-chloropropanoic acid;2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid.
| Compound Name | (2R)-2-chloropropanoic acid;2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 161441258 |
| Molecular Formula | C13H16ClN3O4S2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2R)-2-chloropropanoic acid;2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid |
| SMILES | CC(Sc1nnc(-c2cccs2)n1C)C(=O)O.C[C@@H](Cl)C(=O)O |
| InChI | InChI=1S/C10H11N3O2S2.C3H5ClO2/c1-6(9(14)15)17-10-12-11-8(13(10)2)7-4-3-5-16-7;1-2(4)3(5)6/h3-6H,1-2H3,(H,14,15);2H,1H3,(H,5,6)/t;2-/m.1/s1 |
| InChIKey | VZHNSLMPTQJHHS-ARGLLVQISA-N |
| XLogP | 2.81 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|