C9H11NOS — CID 117035966
S-(2,5-dimethylphenyl) carbamothioate (PubChem CID 117035966) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is S-(2,5-dimethylphenyl) carbamothioate.
| Compound Name | S-(2,5-dimethylphenyl) carbamothioate |
|---|---|
| PubChem CID | 117035966 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | S-(2,5-dimethylphenyl) carbamothioate |
| SMILES | Cc1ccc(C)c(SC(N)=O)c1 |
| InChI | InChI=1S/C9H11NOS/c1-6-3-4-7(2)8(5-6)12-9(10)11/h3-5H,1-2H3,(H2,10,11) |
| InChIKey | ZTAJKHAVLDMQTB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|