C12H16OS — CID 43226054
4-(2,5-dimethylphenyl)sulfanylbutan-2-one (PubChem CID 43226054) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)sulfanylbutan-2-one.
| Compound Name | 4-(2,5-dimethylphenyl)sulfanylbutan-2-one |
|---|---|
| PubChem CID | 43226054 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-(2,5-dimethylphenyl)sulfanylbutan-2-one |
| SMILES | CC(=O)CCSc1cc(C)ccc1C |
| InChI | InChI=1S/C12H16OS/c1-9-4-5-10(2)12(8-9)14-7-6-11(3)13/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | LZNIOTLYHHUSOH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |